About bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate
bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate (PubChem CID 175518550) has the molecular formula C15H23Br3O6
and a molecular weight of 539.06 g/mol. Its IUPAC name is bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate.
Molecular Properties
| Compound Name | bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate |
| PubChem CID | 175518550 |
| Molecular Formula | C15H23Br3O6 |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 535.90 |
| IUPAC Name | bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate |
| SMILES | C#CCOC(=O)C(C)(C)Br.CC(C)(Br)C(=O)O.CC(C)(Br)C(=O)O |
| InChI | InChI=1S/C7H9BrO2.2C4H7BrO2/c1-4-5-10-6(9)7(2,3)8;2*1-4(2,5)3(6)7/h1H,5H2,2-3H3;2*1-2H3,(H,6,7) |
| InChIKey | MBDMUPWIIPDVJL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate?
The IUPAC name of bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate (CID 175518550) is bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate.
What is the SMILES notation for bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate?
The canonical SMILES for bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate is C#CCOC(=O)C(C)(C)Br.CC(C)(Br)C(=O)O.CC(C)(Br)C(=O)O.
What is the InChIKey of bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate?
The InChIKey is MBDMUPWIIPDVJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrO2.2C4H7BrO2/c1-4-5-10-6(9)7(2,3)8;2*1-4(2,5)3(6)7/h1H,5H2,2-3H3;2*1-2H3,(H,6,7).
What are the key properties of bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate?
bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate has a molecular weight of 539.06 g/mol, XLogP of 3.83, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-bromo-2-methylpropanoic acid);prop-2-ynyl 2-bromo-2-methylpropanoate is sourced from PubChem (CID 175518550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).