About 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole
3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole (PubChem CID 175519372) has the molecular formula C28H13F12N
and a molecular weight of 591.40 g/mol. Its IUPAC name is 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole.
Molecular Properties
| Compound Name | 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole |
| PubChem CID | 175519372 |
| Molecular Formula | C28H13F12N |
| Molecular Weight | 591.40 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole |
| SMILES | FC(F)(F)c1cc(-c2ccc3[nH]c4ccc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cc4c3c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H13F12N/c29-25(30,31)17-5-15(6-18(11-17)26(32,33)34)13-1-3-23-21(9-13)22-10-14(2-4-24(22)41-23)16-7-19(27(35,36)37)12-20(8-16)28(38,39)40/h1-12,41H |
| InChIKey | LXOLVDOVYNTNNQ-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 591.40 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole?
The IUPAC name of 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole (CID 175519372) is 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole.
What is the SMILES notation for 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole?
The canonical SMILES for 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole is FC(F)(F)c1cc(-c2ccc3[nH]c4ccc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cc4c3c2)cc(C(F)(F)F)c1.
What is the InChIKey of 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole?
The InChIKey is LXOLVDOVYNTNNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H13F12N/c29-25(30,31)17-5-15(6-18(11-17)26(32,33)34)13-1-3-23-21(9-13)22-10-14(2-4-24(22)41-23)16-7-19(27(35,36)37)12-20(8-16)28(38,39)40/h1-12,41H.
What are the key properties of 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole?
3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole has a molecular weight of 591.40 g/mol, XLogP of 10.73, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis[3,5-bis(trifluoromethyl)phenyl]-9H-carbazole is sourced from PubChem (CID 175519372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).