About naphtho[2,3-g]quinoline;penta-1,3-diene
naphtho[2,3-g]quinoline;penta-1,3-diene (PubChem CID 175519741) has the molecular formula C22H19N
and a molecular weight of 297.40 g/mol. Its IUPAC name is naphtho[2,3-g]quinoline;penta-1,3-diene.
Molecular Properties
| Compound Name | naphtho[2,3-g]quinoline;penta-1,3-diene |
| PubChem CID | 175519741 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | naphtho[2,3-g]quinoline;penta-1,3-diene |
| SMILES | C=CC=CC.c1ccc2cc3cc4ncccc4cc3cc2c1 |
| InChI | InChI=1S/C17H11N.C5H8/c1-2-5-13-9-16-11-17-14(6-3-7-18-17)10-15(16)8-12(13)4-1;1-3-5-4-2/h1-11H;3-5H,1H2,2H3 |
| InChIKey | ADNSQMKAJZTIDV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze naphtho[2,3-g]quinoline;penta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[2,3-g]quinoline;penta-1,3-diene?
The IUPAC name of naphtho[2,3-g]quinoline;penta-1,3-diene (CID 175519741) is naphtho[2,3-g]quinoline;penta-1,3-diene.
What is the SMILES notation for naphtho[2,3-g]quinoline;penta-1,3-diene?
The canonical SMILES for naphtho[2,3-g]quinoline;penta-1,3-diene is C=CC=CC.c1ccc2cc3cc4ncccc4cc3cc2c1.
What is the InChIKey of naphtho[2,3-g]quinoline;penta-1,3-diene?
The InChIKey is ADNSQMKAJZTIDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N.C5H8/c1-2-5-13-9-16-11-17-14(6-3-7-18-17)10-15(16)8-12(13)4-1;1-3-5-4-2/h1-11H;3-5H,1H2,2H3.
What are the key properties of naphtho[2,3-g]quinoline;penta-1,3-diene?
naphtho[2,3-g]quinoline;penta-1,3-diene has a molecular weight of 297.40 g/mol, XLogP of 6.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[2,3-g]quinoline;penta-1,3-diene is sourced from PubChem (CID 175519741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).