C22H24O5 — CID 175519753
methyl (Z)-2-(4-acetylphenyl)-4-(7a-methyl-5-oxo-2,3,3a,4-tetrahydro-1-benzofuran-3-yl)but-2-enoate (PubChem CID 175519753) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (Z)-2-(4-acetylphenyl)-4-(7a-methyl-5-oxo-2,3,3a,4-tetrahydro-1-benzofuran-3-yl)but-2-enoate.
| Compound Name | methyl (Z)-2-(4-acetylphenyl)-4-(7a-methyl-5-oxo-2,3,3a,4-tetrahydro-1-benzofuran-3-yl)but-2-enoate |
|---|---|
| PubChem CID | 175519753 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methyl (Z)-2-(4-acetylphenyl)-4-(7a-methyl-5-oxo-2,3,3a,4-tetrahydro-1-benzofuran-3-yl)but-2-enoate |
| SMILES | COC(=O)/C(=C\CC1COC2(C)C=CC(=O)CC12)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H24O5/c1-14(23)15-4-6-16(7-5-15)19(21(25)26-3)9-8-17-13-27-22(2)11-10-18(24)12-20(17)22/h4-7,9-11,17,20H,8,12-13H2,1-3H3/b19-9- |
| InChIKey | FXOLEMNDDGGCCO-OCKHKDLRSA-N |
| XLogP | 3.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|