C20H21FO4 — CID 175519763
methyl (Z)-4-(7a-methyl-5-oxo-2,3,3a,4-tetrahydro-1-benzofuran-3-yl)-2-(4-fluorophenyl)but-2-enoate (PubChem CID 175519763) has the molecular formula C20H21FO4 and a molecular weight of 344.38 g/mol. Its IUPAC name is methyl (Z)-4-(7a-methyl-5-oxo-2,3,3a,4-tetrahydro-1-benzofuran-3-yl)-2-(4-fluorophenyl)but-2-enoate.
| Compound Name | methyl (Z)-4-(7a-methyl-5-oxo-2,3,3a,4-tetrahydro-1-benzofuran-3-yl)-2-(4-fluorophenyl)but-2-enoate |
|---|---|
| PubChem CID | 175519763 |
| Molecular Formula | C20H21FO4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | methyl (Z)-4-(7a-methyl-5-oxo-2,3,3a,4-tetrahydro-1-benzofuran-3-yl)-2-(4-fluorophenyl)but-2-enoate |
| SMILES | COC(=O)/C(=C\CC1COC2(C)C=CC(=O)CC12)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FO4/c1-20-10-9-16(22)11-18(20)14(12-25-20)5-8-17(19(23)24-2)13-3-6-15(21)7-4-13/h3-4,6-10,14,18H,5,11-12H2,1-2H3/b17-8- |
| InChIKey | IMCLXRNVYIMZHE-IUXPMGMMSA-N |
| XLogP | 3.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|