C21H26N2O5Si — CID 175519777
(5R)-2'-oxo-1'-(2-trimethylsilylethoxymethyl)spiro[6,7-dihydro-4H-1-benzofuran-5,3'-pyrrolo[2,3-b]pyridine]-2-carboxylic acid (PubChem CID 175519777) has the molecular formula C21H26N2O5Si and a molecular weight of 414.53 g/mol. Its IUPAC name is (5R)-2'-oxo-1'-(2-trimethylsilylethoxymethyl)spiro[6,7-dihydro-4H-1-benzofuran-5,3'-pyrrolo[2,3-b]pyridine]-2-carboxylic acid.
| Compound Name | (5R)-2'-oxo-1'-(2-trimethylsilylethoxymethyl)spiro[6,7-dihydro-4H-1-benzofuran-5,3'-pyrrolo[2,3-b]pyridine]-2-carboxylic acid |
|---|---|
| PubChem CID | 175519777 |
| Molecular Formula | C21H26N2O5Si |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (5R)-2'-oxo-1'-(2-trimethylsilylethoxymethyl)spiro[6,7-dihydro-4H-1-benzofuran-5,3'-pyrrolo[2,3-b]pyridine]-2-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCN1C(=O)[C@@]2(CCc3oc(C(=O)O)cc3C2)c2cccnc21 |
| InChI | InChI=1S/C21H26N2O5Si/c1-29(2,3)10-9-27-13-23-18-15(5-4-8-22-18)21(20(23)26)7-6-16-14(12-21)11-17(28-16)19(24)25/h4-5,8,11H,6-7,9-10,12-13H2,1-3H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | BWUIZWXXYFMRPJ-OAQYLSRUSA-N |
| XLogP | 3.46 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|