C15H16F6N2O7S — CID 175520045
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[5-(trifluoromethyl)-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid (PubChem CID 175520045) has the molecular formula C15H16F6N2O7S and a molecular weight of 482.36 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[5-(trifluoromethyl)-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[5-(trifluoromethyl)-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 175520045 |
| Molecular Formula | C15H16F6N2O7S |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[5-(trifluoromethyl)-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(C(F)(F)F)cnc1OS(=O)(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H16F6N2O7S/c1-13(2,3)29-12(26)23-9(11(24)25)5-7-4-8(14(16,17)18)6-22-10(7)30-31(27,28)15(19,20)21/h4,6,9H,5H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | XCRUYRVWNYJAOE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|