C27H32F3N5O4S — CID 175520827
[2-[[2-amino-6-[(2-imino-5-methyl-1,3-oxazol-3-yl)methyl]phenyl]carbamoylsulfanylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate (PubChem CID 175520827) has the molecular formula C27H32F3N5O4S and a molecular weight of 579.65 g/mol. Its IUPAC name is [2-[[2-amino-6-[(2-imino-5-methyl-1,3-oxazol-3-yl)methyl]phenyl]carbamoylsulfanylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-6-[(2-imino-5-methyl-1,3-oxazol-3-yl)methyl]phenyl]carbamoylsulfanylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175520827 |
| Molecular Formula | C27H32F3N5O4S |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | [2-[[2-amino-6-[(2-imino-5-methyl-1,3-oxazol-3-yl)methyl]phenyl]carbamoylsulfanylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
| SMILES | [H]/N=c1\oc(C)cn1Cc1cccc(N)c1NC(=O)SNC(C)(COC(=O)C(C)(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H32F3N5O4S/c1-16-13-35(23(32)39-16)14-17-8-6-11-20(31)21(17)33-24(37)40-34-26(5,15-38-22(36)25(2,3)4)18-9-7-10-19(12-18)27(28,29)30/h6-13,32,34H,14-15,31H2,1-5H3,(H,33,37)/b32-23- |
| InChIKey | JZYDTHUUHONJTQ-SJIPCVTESA-N |
| XLogP | 5.79 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|