C13H23N3O2 — CID 175520912
(3-imidazol-1-yl-2,2-dimethylheptan-3-yl) carbamate (PubChem CID 175520912) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is (3-imidazol-1-yl-2,2-dimethylheptan-3-yl) carbamate.
| Compound Name | (3-imidazol-1-yl-2,2-dimethylheptan-3-yl) carbamate |
|---|---|
| PubChem CID | 175520912 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (3-imidazol-1-yl-2,2-dimethylheptan-3-yl) carbamate |
| SMILES | CCCCC(OC(N)=O)(n1ccnc1)C(C)(C)C |
| InChI | InChI=1S/C13H23N3O2/c1-5-6-7-13(12(2,3)4,18-11(14)17)16-9-8-15-10-16/h8-10H,5-7H2,1-4H3,(H2,14,17) |
| InChIKey | SRXACXYLJYOUOS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |