About potassium;(3-ethenylphenyl)boronic acid;hydride
potassium;(3-ethenylphenyl)boronic acid;hydride (PubChem CID 175521054) has the molecular formula C8H10BKO2
and a molecular weight of 188.08 g/mol. Its IUPAC name is potassium;(3-ethenylphenyl)boronic acid;hydride.
Molecular Properties
| Compound Name | potassium;(3-ethenylphenyl)boronic acid;hydride |
| PubChem CID | 175521054 |
| Molecular Formula | C8H10BKO2 |
| Molecular Weight | 188.08 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | potassium;(3-ethenylphenyl)boronic acid;hydride |
| SMILES | C=Cc1cccc(B(O)O)c1.[H-].[K+] |
| InChI | InChI=1S/C8H9BO2.K.H/c1-2-7-4-3-5-8(6-7)9(10)11;;/h2-6,10-11H,1H2;;/q;+1;-1 |
| InChIKey | ZMCAXGGYGMRRSO-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.08 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;(3-ethenylphenyl)boronic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(3-ethenylphenyl)boronic acid;hydride?
The IUPAC name of potassium;(3-ethenylphenyl)boronic acid;hydride (CID 175521054) is potassium;(3-ethenylphenyl)boronic acid;hydride.
What is the SMILES notation for potassium;(3-ethenylphenyl)boronic acid;hydride?
The canonical SMILES for potassium;(3-ethenylphenyl)boronic acid;hydride is C=Cc1cccc(B(O)O)c1.[H-].[K+].
What is the InChIKey of potassium;(3-ethenylphenyl)boronic acid;hydride?
The InChIKey is ZMCAXGGYGMRRSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BO2.K.H/c1-2-7-4-3-5-8(6-7)9(10)11;;/h2-6,10-11H,1H2;;/q;+1;-1.
What are the key properties of potassium;(3-ethenylphenyl)boronic acid;hydride?
potassium;(3-ethenylphenyl)boronic acid;hydride has a molecular weight of 188.08 g/mol, XLogP of -2.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(3-ethenylphenyl)boronic acid;hydride is sourced from PubChem (CID 175521054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).