C37H28Br2N4O7S — CID 175521225
N-[(2S)-3-[4-[(4-bromophenyl)methoxy]phenyl]-1-(4-nitrophenyl)sulfonyl-1-oxopropan-2-yl]-1-[(4-bromophenyl)methyl]pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 175521225) has the molecular formula C37H28Br2N4O7S and a molecular weight of 832.53 g/mol. Its IUPAC name is N-[(2S)-3-[4-[(4-bromophenyl)methoxy]phenyl]-1-(4-nitrophenyl)sulfonyl-1-oxopropan-2-yl]-1-[(4-bromophenyl)methyl]pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-3-[4-[(4-bromophenyl)methoxy]phenyl]-1-(4-nitrophenyl)sulfonyl-1-oxopropan-2-yl]-1-[(4-bromophenyl)methyl]pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175521225 |
| Molecular Formula | C37H28Br2N4O7S |
| Molecular Weight | 832.53 g/mol |
| Exact Mass | 830.00 |
| IUPAC Name | N-[(2S)-3-[4-[(4-bromophenyl)methoxy]phenyl]-1-(4-nitrophenyl)sulfonyl-1-oxopropan-2-yl]-1-[(4-bromophenyl)methyl]pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccc(OCc2ccc(Br)cc2)cc1)C(=O)S(=O)(=O)c1ccc([N+](=O)[O-])cc1)c1cn(Cc2ccc(Br)cc2)c2ncccc12 |
| InChI | InChI=1S/C37H28Br2N4O7S/c38-27-9-3-25(4-10-27)21-42-22-33(32-2-1-19-40-35(32)42)36(44)41-34(37(45)51(48,49)31-17-13-29(14-18-31)43(46)47)20-24-7-15-30(16-8-24)50-23-26-5-11-28(39)12-6-26/h1-19,22,34H,20-21,23H2,(H,41,44)/t34-/m0/s1 |
| InChIKey | RUMTXRMNLIEXAT-UMSFTDKQSA-N |
| XLogP | 7.44 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.53 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|