C8H4O2Te2 — CID 175521421
3,4-ditellurabicyclo[4.3.1]deca-1(10),6,8-triene-2,5-dione (PubChem CID 175521421) has the molecular formula C8H4O2Te2 and a molecular weight of 387.32 g/mol. Its IUPAC name is 3,4-ditellurabicyclo[4.3.1]deca-1(10),6,8-triene-2,5-dione.
| Compound Name | 3,4-ditellurabicyclo[4.3.1]deca-1(10),6,8-triene-2,5-dione |
|---|---|
| PubChem CID | 175521421 |
| Molecular Formula | C8H4O2Te2 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 391.83 |
| IUPAC Name | 3,4-ditellurabicyclo[4.3.1]deca-1(10),6,8-triene-2,5-dione |
| SMILES | O=C1[Te][Te]C(=O)c2cccc1c2 |
| InChI | InChI=1S/C8H4O2Te2/c9-7-5-2-1-3-6(4-5)8(10)12-11-7/h1-4H |
| InChIKey | BIDCTHMXUODTJN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|