About 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane
1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane (PubChem CID 175522036) has the molecular formula C14H19FeN-6
and a molecular weight of 257.16 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane |
| PubChem CID | 175522036 |
| Molecular Formula | C14H19FeN-6 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane |
| SMILES | CN(C)C[c-]1cccc1.C[c-]1[cH-][cH-][cH-][cH-]1.[Fe] |
| InChI | InChI=1S/C8H12N.C6H7.Fe/c1-9(2)7-8-5-3-4-6-8;1-6-4-2-3-5-6;/h3-6H,7H2,1-2H3;2-5H,1H3;/q-1;-5; |
| InChIKey | VQVMIDJKPPCVDL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane?
The IUPAC name of 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane (CID 175522036) is 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane is CN(C)C[c-]1cccc1.C[c-]1[cH-][cH-][cH-][cH-]1.[Fe].
What is the InChIKey of 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane?
The InChIKey is VQVMIDJKPPCVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N.C6H7.Fe/c1-9(2)7-8-5-3-4-6-8;1-6-4-2-3-5-6;/h3-6H,7H2,1-2H3;2-5H,1H3;/q-1;-5;.
What are the key properties of 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane?
1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane has a molecular weight of 257.16 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;iron;methylcyclopentane is sourced from PubChem (CID 175522036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).