C18H22O2 — CID 175522173
2-butyl-1,2,3,4,4a,9a-hexahydroanthracene-9,10-dione (PubChem CID 175522173) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-butyl-1,2,3,4,4a,9a-hexahydroanthracene-9,10-dione.
| Compound Name | 2-butyl-1,2,3,4,4a,9a-hexahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 175522173 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-butyl-1,2,3,4,4a,9a-hexahydroanthracene-9,10-dione |
| SMILES | CCCCC1CCC2C(=O)c3ccccc3C(=O)C2C1 |
| InChI | InChI=1S/C18H22O2/c1-2-3-6-12-9-10-15-16(11-12)18(20)14-8-5-4-7-13(14)17(15)19/h4-5,7-8,12,15-16H,2-3,6,9-11H2,1H3 |
| InChIKey | TXNLRPMQRFJEIC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|