C22H22N2O5 — CID 175522300
1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid;1H-phenalene-1,4-diamine (PubChem CID 175522300) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid;1H-phenalene-1,4-diamine.
| Compound Name | 1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid;1H-phenalene-1,4-diamine |
|---|---|
| PubChem CID | 175522300 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid;1H-phenalene-1,4-diamine |
| SMILES | Nc1ccc2cccc3c2c1C=CC3N.O=C(O)C1CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C13H12N2.C9H10O5/c14-11-6-4-8-2-1-3-9-12(15)7-5-10(11)13(8)9;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h1-7,12H,14-15H2;4-6H,1-3H2,(H,10,11) |
| InChIKey | SJRTZUDAEXEDOU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|