About 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine
2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine (PubChem CID 175522930) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine.
Molecular Properties
| Compound Name | 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine |
| PubChem CID | 175522930 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine |
| SMILES | Cc1cc[nH]c1C.NCC1CO1 |
| InChI | InChI=1S/C6H9N.C3H7NO/c1-5-3-4-7-6(5)2;4-1-3-2-5-3/h3-4,7H,1-2H3;3H,1-2,4H2 |
| InChIKey | OISZUVBNBDAFLL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine?
The IUPAC name of 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine (CID 175522930) is 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine.
What is the SMILES notation for 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine?
The canonical SMILES for 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine is Cc1cc[nH]c1C.NCC1CO1.
What is the InChIKey of 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine?
The InChIKey is OISZUVBNBDAFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.C3H7NO/c1-5-3-4-7-6(5)2;4-1-3-2-5-3/h3-4,7H,1-2H3;3H,1-2,4H2.
What are the key properties of 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine?
2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine has a molecular weight of 168.24 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1H-pyrrole;oxiran-2-ylmethanamine is sourced from PubChem (CID 175522930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).