About 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole
1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole (PubChem CID 175523157) has the molecular formula C11H10N4
and a molecular weight of 198.23 g/mol. Its IUPAC name is 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole.
Molecular Properties
| Compound Name | 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole |
| PubChem CID | 175523157 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole |
| SMILES | C1=CCC(c2nnnn2C2=CC=CC2)=C1 |
| InChI | InChI=1S/C11H10N4/c1-2-6-9(5-1)11-12-13-14-15(11)10-7-3-4-8-10/h1-5,7H,6,8H2 |
| InChIKey | OVXMTGCOJUPTOV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole?
The IUPAC name of 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole (CID 175523157) is 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole.
What is the SMILES notation for 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole?
The canonical SMILES for 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole is C1=CCC(c2nnnn2C2=CC=CC2)=C1.
What is the InChIKey of 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole?
The InChIKey is OVXMTGCOJUPTOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4/c1-2-6-9(5-1)11-12-13-14-15(11)10-7-3-4-8-10/h1-5,7H,6,8H2.
What are the key properties of 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole?
1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole has a molecular weight of 198.23 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-di(cyclopenta-1,3-dien-1-yl)tetrazole is sourced from PubChem (CID 175523157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).