About [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate
[3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate (PubChem CID 175523608) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate.
Molecular Properties
| Compound Name | [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate |
| PubChem CID | 175523608 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate |
| SMILES | CC(C)(C)C(C)(NC(=O)c1cocn1)OC(N)=O |
| InChI | InChI=1S/C11H17N3O4/c1-10(2,3)11(4,18-9(12)16)14-8(15)7-5-17-6-13-7/h5-6H,1-4H3,(H2,12,16)(H,14,15) |
| InChIKey | ZAZXKCQYWVNEAQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate?
The IUPAC name of [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate (CID 175523608) is [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate.
What is the SMILES notation for [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate?
The canonical SMILES for [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate is CC(C)(C)C(C)(NC(=O)c1cocn1)OC(N)=O.
What is the InChIKey of [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate?
The InChIKey is ZAZXKCQYWVNEAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O4/c1-10(2,3)11(4,18-9(12)16)14-8(15)7-5-17-6-13-7/h5-6H,1-4H3,(H2,12,16)(H,14,15).
What are the key properties of [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate?
[3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate has a molecular weight of 255.27 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-dimethyl-2-(1,3-oxazole-4-carbonylamino)butan-2-yl] carbamate is sourced from PubChem (CID 175523608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).