methyl 4-phenylbut-3-enoate;molecular nitrogen

C11H12N2O2 — CID 175524038

IUPACmethyl 4-phenylbut-3-enoate;molecular nitrogen
SMILESCOC(=O)CC=Cc1ccccc1.N#N
InChIInChI=1S/C11H12O2.N2/c1-13-11(12)9-5-8-10-6-3-2-4-7-10;1-2/h2-8H,9H2,1H3;
InChIKeyVEEANMJCMZSADV-UHFFFAOYSA-N
MW204.23 g/mol
LogP2.29
Rot. Bonds3

About methyl 4-phenylbut-3-enoate;molecular nitrogen

methyl 4-phenylbut-3-enoate;molecular nitrogen (PubChem CID 175524038) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is methyl 4-phenylbut-3-enoate;molecular nitrogen.

Molecular Properties

Compound Namemethyl 4-phenylbut-3-enoate;molecular nitrogen
PubChem CID175524038
Molecular FormulaC11H12N2O2
Molecular Weight204.23 g/mol
Exact Mass204.09
IUPAC Namemethyl 4-phenylbut-3-enoate;molecular nitrogen
SMILESCOC(=O)CC=Cc1ccccc1.N#N
InChIInChI=1S/C11H12O2.N2/c1-13-11(12)9-5-8-10-6-3-2-4-7-10;1-2/h2-8H,9H2,1H3;
InChIKeyVEEANMJCMZSADV-UHFFFAOYSA-N
XLogP2.29
TPSA73.88 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.23
LogP ≤ 52.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}

Analyze methyl 4-phenylbut-3-enoate;molecular nitrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-phenylbut-3-enoate;molecular nitrogen?
The IUPAC name of methyl 4-phenylbut-3-enoate;molecular nitrogen (CID 175524038) is methyl 4-phenylbut-3-enoate;molecular nitrogen.
What is the SMILES notation for methyl 4-phenylbut-3-enoate;molecular nitrogen?
The canonical SMILES for methyl 4-phenylbut-3-enoate;molecular nitrogen is COC(=O)CC=Cc1ccccc1.N#N.
What is the InChIKey of methyl 4-phenylbut-3-enoate;molecular nitrogen?
The InChIKey is VEEANMJCMZSADV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.N2/c1-13-11(12)9-5-8-10-6-3-2-4-7-10;1-2/h2-8H,9H2,1H3;.
What are the key properties of methyl 4-phenylbut-3-enoate;molecular nitrogen?
methyl 4-phenylbut-3-enoate;molecular nitrogen has a molecular weight of 204.23 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-phenylbut-3-enoate;molecular nitrogen is sourced from PubChem (CID 175524038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).