About methyl 4-phenylbut-3-enoate;molecular nitrogen
methyl 4-phenylbut-3-enoate;molecular nitrogen (PubChem CID 175524038) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is methyl 4-phenylbut-3-enoate;molecular nitrogen.
Molecular Properties
| Compound Name | methyl 4-phenylbut-3-enoate;molecular nitrogen |
| PubChem CID | 175524038 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | methyl 4-phenylbut-3-enoate;molecular nitrogen |
| SMILES | COC(=O)CC=Cc1ccccc1.N#N |
| InChI | InChI=1S/C11H12O2.N2/c1-13-11(12)9-5-8-10-6-3-2-4-7-10;1-2/h2-8H,9H2,1H3; |
| InChIKey | VEEANMJCMZSADV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-phenylbut-3-enoate;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-phenylbut-3-enoate;molecular nitrogen?
The IUPAC name of methyl 4-phenylbut-3-enoate;molecular nitrogen (CID 175524038) is methyl 4-phenylbut-3-enoate;molecular nitrogen.
What is the SMILES notation for methyl 4-phenylbut-3-enoate;molecular nitrogen?
The canonical SMILES for methyl 4-phenylbut-3-enoate;molecular nitrogen is COC(=O)CC=Cc1ccccc1.N#N.
What is the InChIKey of methyl 4-phenylbut-3-enoate;molecular nitrogen?
The InChIKey is VEEANMJCMZSADV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.N2/c1-13-11(12)9-5-8-10-6-3-2-4-7-10;1-2/h2-8H,9H2,1H3;.
What are the key properties of methyl 4-phenylbut-3-enoate;molecular nitrogen?
methyl 4-phenylbut-3-enoate;molecular nitrogen has a molecular weight of 204.23 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-phenylbut-3-enoate;molecular nitrogen is sourced from PubChem (CID 175524038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).