About 1,3-dioxolan-2-one;methyl cycloheptanesulfonate
1,3-dioxolan-2-one;methyl cycloheptanesulfonate (PubChem CID 175524178) has the molecular formula C11H20O6S
and a molecular weight of 280.34 g/mol. Its IUPAC name is 1,3-dioxolan-2-one;methyl cycloheptanesulfonate.
Molecular Properties
| Compound Name | 1,3-dioxolan-2-one;methyl cycloheptanesulfonate |
| PubChem CID | 175524178 |
| Molecular Formula | C11H20O6S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1,3-dioxolan-2-one;methyl cycloheptanesulfonate |
| SMILES | COS(=O)(=O)C1CCCCCC1.O=C1OCCO1 |
| InChI | InChI=1S/C8H16O3S.C3H4O3/c1-11-12(9,10)8-6-4-2-3-5-7-8;4-3-5-1-2-6-3/h8H,2-7H2,1H3;1-2H2 |
| InChIKey | MXEIYVXVECYPQY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxolan-2-one;methyl cycloheptanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxolan-2-one;methyl cycloheptanesulfonate?
The IUPAC name of 1,3-dioxolan-2-one;methyl cycloheptanesulfonate (CID 175524178) is 1,3-dioxolan-2-one;methyl cycloheptanesulfonate.
What is the SMILES notation for 1,3-dioxolan-2-one;methyl cycloheptanesulfonate?
The canonical SMILES for 1,3-dioxolan-2-one;methyl cycloheptanesulfonate is COS(=O)(=O)C1CCCCCC1.O=C1OCCO1.
What is the InChIKey of 1,3-dioxolan-2-one;methyl cycloheptanesulfonate?
The InChIKey is MXEIYVXVECYPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3S.C3H4O3/c1-11-12(9,10)8-6-4-2-3-5-7-8;4-3-5-1-2-6-3/h8H,2-7H2,1H3;1-2H2.
What are the key properties of 1,3-dioxolan-2-one;methyl cycloheptanesulfonate?
1,3-dioxolan-2-one;methyl cycloheptanesulfonate has a molecular weight of 280.34 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxolan-2-one;methyl cycloheptanesulfonate is sourced from PubChem (CID 175524178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).