About 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole
1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole (PubChem CID 175524211) has the molecular formula C12H15F3N2O2
and a molecular weight of 276.26 g/mol. Its IUPAC name is 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole.
Molecular Properties
| Compound Name | 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole |
| PubChem CID | 175524211 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole |
| SMILES | FC(F)(F)OC[C@@H]1C[C@H]1c1cnn(C2CCCO2)c1 |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)19-7-8-4-10(8)9-5-16-17(6-9)11-2-1-3-18-11/h5-6,8,10-11H,1-4,7H2/t8-,10+,11?/m0/s1 |
| InChIKey | ZNRZAPINHULWAG-OZRKRLJNSA-N |
| XLogP | 2.83 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole?
The IUPAC name of 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole (CID 175524211) is 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole.
What is the SMILES notation for 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole?
The canonical SMILES for 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole is FC(F)(F)OC[C@@H]1C[C@H]1c1cnn(C2CCCO2)c1.
What is the InChIKey of 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole?
The InChIKey is ZNRZAPINHULWAG-OZRKRLJNSA-N. The full InChI is InChI=1S/C12H15F3N2O2/c13-12(14,15)19-7-8-4-10(8)9-5-16-17(6-9)11-2-1-3-18-11/h5-6,8,10-11H,1-4,7H2/t8-,10+,11?/m0/s1.
What are the key properties of 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole?
1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole has a molecular weight of 276.26 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-2-yl)-4-[(1R,2R)-2-(trifluoromethoxymethyl)cyclopropyl]pyrazole is sourced from PubChem (CID 175524211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).