C33H46N4O6S — CID 175524863
N-[1-[4-(3,3-dimethyl-2-oxoindol-1-yl)piperidin-1-yl]-1-oxo-4-phenylbutan-2-yl]piperidine-3-carboxamide;ethanesulfonic acid (PubChem CID 175524863) has the molecular formula C33H46N4O6S and a molecular weight of 626.82 g/mol. Its IUPAC name is N-[1-[4-(3,3-dimethyl-2-oxoindol-1-yl)piperidin-1-yl]-1-oxo-4-phenylbutan-2-yl]piperidine-3-carboxamide;ethanesulfonic acid.
| Compound Name | N-[1-[4-(3,3-dimethyl-2-oxoindol-1-yl)piperidin-1-yl]-1-oxo-4-phenylbutan-2-yl]piperidine-3-carboxamide;ethanesulfonic acid |
|---|---|
| PubChem CID | 175524863 |
| Molecular Formula | C33H46N4O6S |
| Molecular Weight | 626.82 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | N-[1-[4-(3,3-dimethyl-2-oxoindol-1-yl)piperidin-1-yl]-1-oxo-4-phenylbutan-2-yl]piperidine-3-carboxamide;ethanesulfonic acid |
| SMILES | CC1(C)C(=O)N(C2CCN(C(=O)C(CCc3ccccc3)NC(=O)C3CCCNC3)CC2)c2ccccc21.CCS(=O)(=O)O |
| InChI | InChI=1S/C31H40N4O3.C2H6O3S/c1-31(2)25-12-6-7-13-27(25)35(30(31)38)24-16-19-34(20-17-24)29(37)26(15-14-22-9-4-3-5-10-22)33-28(36)23-11-8-18-32-21-23;1-2-6(3,4)5/h3-7,9-10,12-13,23-24,26,32H,8,11,14-21H2,1-2H3,(H,33,36);2H2,1H3,(H,3,4,5) |
| InChIKey | PIBROQNAXQQMOW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.82 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|