About bromogold;imidazol-3-ide;methoxybenzene
bromogold;imidazol-3-ide;methoxybenzene (PubChem CID 175524899) has the molecular formula C10H10AuBrN2O-2
and a molecular weight of 451.07 g/mol. Its IUPAC name is bromogold;imidazol-3-ide;methoxybenzene.
Molecular Properties
| Compound Name | bromogold;imidazol-3-ide;methoxybenzene |
| PubChem CID | 175524899 |
| Molecular Formula | C10H10AuBrN2O-2 |
| Molecular Weight | 451.07 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | bromogold;imidazol-3-ide;methoxybenzene |
| SMILES | Br[Au].COc1cc[c-]cc1.c1c[n-]cn1 |
| InChI | InChI=1S/C7H7O.C3H3N2.Au.BrH/c1-8-7-5-3-2-4-6-7;1-2-5-3-4-1;;/h3-6H,1H3;1-3H;;1H/q2*-1;+1;/p-1 |
| InChIKey | SOSBEHJUNOMNGE-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 36.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.07 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bromogold;imidazol-3-ide;methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromogold;imidazol-3-ide;methoxybenzene?
The IUPAC name of bromogold;imidazol-3-ide;methoxybenzene (CID 175524899) is bromogold;imidazol-3-ide;methoxybenzene.
What is the SMILES notation for bromogold;imidazol-3-ide;methoxybenzene?
The canonical SMILES for bromogold;imidazol-3-ide;methoxybenzene is Br[Au].COc1cc[c-]cc1.c1c[n-]cn1.
What is the InChIKey of bromogold;imidazol-3-ide;methoxybenzene?
The InChIKey is SOSBEHJUNOMNGE-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7O.C3H3N2.Au.BrH/c1-8-7-5-3-2-4-6-7;1-2-5-3-4-1;;/h3-6H,1H3;1-3H;;1H/q2*-1;+1;/p-1.
What are the key properties of bromogold;imidazol-3-ide;methoxybenzene?
bromogold;imidazol-3-ide;methoxybenzene has a molecular weight of 451.07 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromogold;imidazol-3-ide;methoxybenzene is sourced from PubChem (CID 175524899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).