About (3-ethylanilino) thiohypofluorite
(3-ethylanilino) thiohypofluorite (PubChem CID 175524944) has the molecular formula C8H10FNS
and a molecular weight of 171.24 g/mol. Its IUPAC name is (3-ethylanilino) thiohypofluorite.
Molecular Properties
| Compound Name | (3-ethylanilino) thiohypofluorite |
| PubChem CID | 175524944 |
| Molecular Formula | C8H10FNS |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (3-ethylanilino) thiohypofluorite |
| SMILES | CCc1cccc(NSF)c1 |
| InChI | InChI=1S/C8H10FNS/c1-2-7-4-3-5-8(6-7)10-11-9/h3-6,10H,2H2,1H3 |
| InChIKey | VZBWFSYVOPHOJM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-ethylanilino) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylanilino) thiohypofluorite?
The IUPAC name of (3-ethylanilino) thiohypofluorite (CID 175524944) is (3-ethylanilino) thiohypofluorite.
What is the SMILES notation for (3-ethylanilino) thiohypofluorite?
The canonical SMILES for (3-ethylanilino) thiohypofluorite is CCc1cccc(NSF)c1.
What is the InChIKey of (3-ethylanilino) thiohypofluorite?
The InChIKey is VZBWFSYVOPHOJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNS/c1-2-7-4-3-5-8(6-7)10-11-9/h3-6,10H,2H2,1H3.
What are the key properties of (3-ethylanilino) thiohypofluorite?
(3-ethylanilino) thiohypofluorite has a molecular weight of 171.24 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylanilino) thiohypofluorite is sourced from PubChem (CID 175524944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).