About 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid
5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid (PubChem CID 175525145) has the molecular formula C14H17IO4
and a molecular weight of 376.19 g/mol. Its IUPAC name is 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid |
| PubChem CID | 175525145 |
| Molecular Formula | C14H17IO4 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(C(=O)O)c(I)c(C(=O)O)c(C)c1C(C)(C)C |
| InChI | InChI=1S/C14H17IO4/c1-6-8(12(16)17)11(15)9(13(18)19)7(2)10(6)14(3,4)5/h1-5H3,(H,16,17)(H,18,19) |
| InChIKey | FFYYHOIHQWJONB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid (CID 175525145) is 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid is Cc1c(C(=O)O)c(I)c(C(=O)O)c(C)c1C(C)(C)C.
What is the InChIKey of 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid?
The InChIKey is FFYYHOIHQWJONB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17IO4/c1-6-8(12(16)17)11(15)9(13(18)19)7(2)10(6)14(3,4)5/h1-5H3,(H,16,17)(H,18,19).
What are the key properties of 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid?
5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid has a molecular weight of 376.19 g/mol, XLogP of 3.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-iodo-4,6-dimethylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 175525145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).