C23H32OS — CID 175525273
(E)-7-(2-methylsulfanylphenyl)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)hept-1-en-3-one (PubChem CID 175525273) has the molecular formula C23H32OS and a molecular weight of 356.58 g/mol. Its IUPAC name is (E)-7-(2-methylsulfanylphenyl)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)hept-1-en-3-one.
| Compound Name | (E)-7-(2-methylsulfanylphenyl)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)hept-1-en-3-one |
|---|---|
| PubChem CID | 175525273 |
| Molecular Formula | C23H32OS |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (E)-7-(2-methylsulfanylphenyl)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)hept-1-en-3-one |
| SMILES | CSc1ccccc1CCCCC(=O)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C23H32OS/c1-18-10-9-17-23(2,3)21(18)16-15-20(24)13-7-5-11-19-12-6-8-14-22(19)25-4/h6,8,10,12,14-16,21H,5,7,9,11,13,17H2,1-4H3/b16-15+ |
| InChIKey | JGSKMUFAQFQKGB-FOCLMDBBSA-N |
| XLogP | 6.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|