About 1-benzylisoquinoline;1H-pyrrole
1-benzylisoquinoline;1H-pyrrole (PubChem CID 175525333) has the molecular formula C20H18N2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-benzylisoquinoline;1H-pyrrole.
Molecular Properties
| Compound Name | 1-benzylisoquinoline;1H-pyrrole |
| PubChem CID | 175525333 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-benzylisoquinoline;1H-pyrrole |
| SMILES | c1cc[nH]c1.c1ccc(Cc2nccc3ccccc23)cc1 |
| InChI | InChI=1S/C16H13N.C4H5N/c1-2-6-13(7-3-1)12-16-15-9-5-4-8-14(15)10-11-17-16;1-2-4-5-3-1/h1-11H,12H2;1-5H |
| InChIKey | XLXNDQHFQGUMAD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzylisoquinoline;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylisoquinoline;1H-pyrrole?
The IUPAC name of 1-benzylisoquinoline;1H-pyrrole (CID 175525333) is 1-benzylisoquinoline;1H-pyrrole.
What is the SMILES notation for 1-benzylisoquinoline;1H-pyrrole?
The canonical SMILES for 1-benzylisoquinoline;1H-pyrrole is c1cc[nH]c1.c1ccc(Cc2nccc3ccccc23)cc1.
What is the InChIKey of 1-benzylisoquinoline;1H-pyrrole?
The InChIKey is XLXNDQHFQGUMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N.C4H5N/c1-2-6-13(7-3-1)12-16-15-9-5-4-8-14(15)10-11-17-16;1-2-4-5-3-1/h1-11H,12H2;1-5H.
What are the key properties of 1-benzylisoquinoline;1H-pyrrole?
1-benzylisoquinoline;1H-pyrrole has a molecular weight of 286.38 g/mol, XLogP of 4.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylisoquinoline;1H-pyrrole is sourced from PubChem (CID 175525333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).