C20H33N3O — CID 175525723
5-[3-(1-adamantylmethyl)-1,2,4-oxadiazol-5-yl]-N,N-dimethylpentan-1-amine (PubChem CID 175525723) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is 5-[3-(1-adamantylmethyl)-1,2,4-oxadiazol-5-yl]-N,N-dimethylpentan-1-amine.
| Compound Name | 5-[3-(1-adamantylmethyl)-1,2,4-oxadiazol-5-yl]-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 175525723 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 5-[3-(1-adamantylmethyl)-1,2,4-oxadiazol-5-yl]-N,N-dimethylpentan-1-amine |
| SMILES | CN(C)CCCCCc1nc(CC23CC4CC(CC(C4)C2)C3)no1 |
| InChI | InChI=1S/C20H33N3O/c1-23(2)7-5-3-4-6-19-21-18(22-24-19)14-20-11-15-8-16(12-20)10-17(9-15)13-20/h15-17H,3-14H2,1-2H3 |
| InChIKey | ICPSDWIJWRACNV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|