About butylaminomethoxyboronic acid
butylaminomethoxyboronic acid (PubChem CID 175525808) has the molecular formula C5H14BNO3
and a molecular weight of 146.98 g/mol. Its IUPAC name is butylaminomethoxyboronic acid.
Molecular Properties
| Compound Name | butylaminomethoxyboronic acid |
| PubChem CID | 175525808 |
| Molecular Formula | C5H14BNO3 |
| Molecular Weight | 146.98 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | butylaminomethoxyboronic acid |
| SMILES | CCCCNCOB(O)O |
| InChI | InChI=1S/C5H14BNO3/c1-2-3-4-7-5-10-6(8)9/h7-9H,2-5H2,1H3 |
| InChIKey | FZGUHKCETWUGLZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.98 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butylaminomethoxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylaminomethoxyboronic acid?
The IUPAC name of butylaminomethoxyboronic acid (CID 175525808) is butylaminomethoxyboronic acid.
What is the SMILES notation for butylaminomethoxyboronic acid?
The canonical SMILES for butylaminomethoxyboronic acid is CCCCNCOB(O)O.
What is the InChIKey of butylaminomethoxyboronic acid?
The InChIKey is FZGUHKCETWUGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14BNO3/c1-2-3-4-7-5-10-6(8)9/h7-9H,2-5H2,1H3.
What are the key properties of butylaminomethoxyboronic acid?
butylaminomethoxyboronic acid has a molecular weight of 146.98 g/mol, XLogP of -0.68, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butylaminomethoxyboronic acid is sourced from PubChem (CID 175525808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).