butylaminomethoxyboronic acid

C5H14BNO3 — CID 175525808

IUPACbutylaminomethoxyboronic acid
SMILESCCCCNCOB(O)O
InChIInChI=1S/C5H14BNO3/c1-2-3-4-7-5-10-6(8)9/h7-9H,2-5H2,1H3
InChIKeyFZGUHKCETWUGLZ-UHFFFAOYSA-N
MW146.98 g/mol
LogP-0.68
Rot. Bonds6

About butylaminomethoxyboronic acid

butylaminomethoxyboronic acid (PubChem CID 175525808) has the molecular formula C5H14BNO3 and a molecular weight of 146.98 g/mol. Its IUPAC name is butylaminomethoxyboronic acid.

Molecular Properties

Compound Namebutylaminomethoxyboronic acid
PubChem CID175525808
Molecular FormulaC5H14BNO3
Molecular Weight146.98 g/mol
Exact Mass147.11
IUPAC Namebutylaminomethoxyboronic acid
SMILESCCCCNCOB(O)O
InChIInChI=1S/C5H14BNO3/c1-2-3-4-7-5-10-6(8)9/h7-9H,2-5H2,1H3
InChIKeyFZGUHKCETWUGLZ-UHFFFAOYSA-N
XLogP-0.68
TPSA61.72 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.98
LogP ≤ 5-0.68
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze butylaminomethoxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butylaminomethoxyboronic acid?
The IUPAC name of butylaminomethoxyboronic acid (CID 175525808) is butylaminomethoxyboronic acid.
What is the SMILES notation for butylaminomethoxyboronic acid?
The canonical SMILES for butylaminomethoxyboronic acid is CCCCNCOB(O)O.
What is the InChIKey of butylaminomethoxyboronic acid?
The InChIKey is FZGUHKCETWUGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14BNO3/c1-2-3-4-7-5-10-6(8)9/h7-9H,2-5H2,1H3.
What are the key properties of butylaminomethoxyboronic acid?
butylaminomethoxyboronic acid has a molecular weight of 146.98 g/mol, XLogP of -0.68, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butylaminomethoxyboronic acid is sourced from PubChem (CID 175525808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).