About 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol
1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol (PubChem CID 175526039) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol |
| PubChem CID | 175526039 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol |
| SMILES | CC(O)Cn1ccc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C12H13NO3/c1-8(14)6-13-3-2-9-4-11-12(5-10(9)13)16-7-15-11/h2-5,8,14H,6-7H2,1H3 |
| InChIKey | KJDNFXKHMLSUCI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol?
The IUPAC name of 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol (CID 175526039) is 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol.
What is the SMILES notation for 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol?
The canonical SMILES for 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol is CC(O)Cn1ccc2cc3c(cc21)OCO3.
What is the InChIKey of 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol?
The InChIKey is KJDNFXKHMLSUCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-8(14)6-13-3-2-9-4-11-12(5-10(9)13)16-7-15-11/h2-5,8,14H,6-7H2,1H3.
What are the key properties of 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol?
1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol has a molecular weight of 219.24 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-([1,3]dioxolo[4,5-f]indol-5-yl)propan-2-ol is sourced from PubChem (CID 175526039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).