C24H32ClN3O2 — CID 175526077
3-chloro-4-[2-(dimethylamino)-3-[(4-methyl-3-phenylpentanoyl)amino]propyl]benzamide (PubChem CID 175526077) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is 3-chloro-4-[2-(dimethylamino)-3-[(4-methyl-3-phenylpentanoyl)amino]propyl]benzamide.
| Compound Name | 3-chloro-4-[2-(dimethylamino)-3-[(4-methyl-3-phenylpentanoyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 175526077 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 3-chloro-4-[2-(dimethylamino)-3-[(4-methyl-3-phenylpentanoyl)amino]propyl]benzamide |
| SMILES | CC(C)C(CC(=O)NCC(Cc1ccc(C(N)=O)cc1Cl)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H32ClN3O2/c1-16(2)21(17-8-6-5-7-9-17)14-23(29)27-15-20(28(3)4)12-18-10-11-19(24(26)30)13-22(18)25/h5-11,13,16,20-21H,12,14-15H2,1-4H3,(H2,26,30)(H,27,29) |
| InChIKey | QZXYLCCGXKVJSO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |