C22H29N3O2 — CID 175526153
3-cyclopropyl-N-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-3-pyridin-3-ylpropanamide (PubChem CID 175526153) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 3-cyclopropyl-N-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-3-pyridin-3-ylpropanamide.
| Compound Name | 3-cyclopropyl-N-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 175526153 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 3-cyclopropyl-N-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-3-pyridin-3-ylpropanamide |
| SMILES | CN(C)C(CNC(=O)CC(c1cccnc1)C1CC1)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-25(2)19(12-16-5-9-20(26)10-6-16)15-24-22(27)13-21(17-7-8-17)18-4-3-11-23-14-18/h3-6,9-11,14,17,19,21,26H,7-8,12-13,15H2,1-2H3,(H,24,27) |
| InChIKey | YXGDHEYUXHWVQS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |