C18H24ClN3O2 — CID 175526668
3-(spiro[2,3-dihydroindene-1,4'-piperidine]-5-ylamino)piperidine-2,6-dione;hydrochloride (PubChem CID 175526668) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 3-(spiro[2,3-dihydroindene-1,4'-piperidine]-5-ylamino)piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-(spiro[2,3-dihydroindene-1,4'-piperidine]-5-ylamino)piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 175526668 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 3-(spiro[2,3-dihydroindene-1,4'-piperidine]-5-ylamino)piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(Nc2ccc3c(c2)CCC32CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C18H23N3O2.ClH/c22-16-4-3-15(17(23)21-16)20-13-1-2-14-12(11-13)5-6-18(14)7-9-19-10-8-18;/h1-2,11,15,19-20H,3-10H2,(H,21,22,23);1H |
| InChIKey | KNDIVLDHCDKBGE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|