C14H19Cl2N — CID 175527113
cis-(1R,2R)-N-butan-2-yl-2-(2,4-dichlorophenyl)cyclobutan-1-amine (PubChem CID 175527113) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is cis-(1R,2R)-N-butan-2-yl-2-(2,4-dichlorophenyl)cyclobutan-1-amine.
| Compound Name | cis-(1R,2R)-N-butan-2-yl-2-(2,4-dichlorophenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 175527113 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | cis-(1R,2R)-N-butan-2-yl-2-(2,4-dichlorophenyl)cyclobutan-1-amine |
| SMILES | CCC(C)N[C@@H]1CC[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N/c1-3-9(2)17-14-7-6-12(14)11-5-4-10(15)8-13(11)16/h4-5,8-9,12,14,17H,3,6-7H2,1-2H3/t9?,12-,14-/m1/s1 |
| InChIKey | OBYFHVKQPOEDLG-NTVGDFDMSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |