C8H14F2N2O — CID 175527940
(2R)-4-(2,2-difluoroethyl)-2-methylpiperazine-1-carbaldehyde (PubChem CID 175527940) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is (2R)-4-(2,2-difluoroethyl)-2-methylpiperazine-1-carbaldehyde.
| Compound Name | (2R)-4-(2,2-difluoroethyl)-2-methylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 175527940 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (2R)-4-(2,2-difluoroethyl)-2-methylpiperazine-1-carbaldehyde |
| SMILES | C[C@@H]1CN(CC(F)F)CCN1C=O |
| InChI | InChI=1S/C8H14F2N2O/c1-7-4-11(5-8(9)10)2-3-12(7)6-13/h6-8H,2-5H2,1H3/t7-/m1/s1 |
| InChIKey | HQBGBEVQSGNWHT-SSDOTTSWSA-N |
| XLogP | 0.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|