About trilithium;oxalyl dicyanide;borate
trilithium;oxalyl dicyanide;borate (PubChem CID 175528192) has the molecular formula C4BLi3N2O5
and a molecular weight of 187.69 g/mol. Its IUPAC name is trilithium;oxalyl dicyanide;borate.
Molecular Properties
| Compound Name | trilithium;oxalyl dicyanide;borate |
| PubChem CID | 175528192 |
| Molecular Formula | C4BLi3N2O5 |
| Molecular Weight | 187.69 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | trilithium;oxalyl dicyanide;borate |
| SMILES | N#CC(=O)C(=O)C#N.[Li+].[Li+].[Li+].[O-]B([O-])[O-] |
| InChI | InChI=1S/C4N2O2.BO3.3Li/c5-1-3(7)4(8)2-6;2-1(3)4;;;/q;-3;3*+1 |
| InChIKey | DPXGIBUIJPIFSI-UHFFFAOYSA-N |
| XLogP | -13.76 |
| TPSA | 150.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.69 |
| LogP ≤ 5 | -13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trilithium;oxalyl dicyanide;borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trilithium;oxalyl dicyanide;borate?
The IUPAC name of trilithium;oxalyl dicyanide;borate (CID 175528192) is trilithium;oxalyl dicyanide;borate.
What is the SMILES notation for trilithium;oxalyl dicyanide;borate?
The canonical SMILES for trilithium;oxalyl dicyanide;borate is N#CC(=O)C(=O)C#N.[Li+].[Li+].[Li+].[O-]B([O-])[O-].
What is the InChIKey of trilithium;oxalyl dicyanide;borate?
The InChIKey is DPXGIBUIJPIFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4N2O2.BO3.3Li/c5-1-3(7)4(8)2-6;2-1(3)4;;;/q;-3;3*+1.
What are the key properties of trilithium;oxalyl dicyanide;borate?
trilithium;oxalyl dicyanide;borate has a molecular weight of 187.69 g/mol, XLogP of -13.76, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for trilithium;oxalyl dicyanide;borate is sourced from PubChem (CID 175528192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).