C20H36N6O9S — CID 175529906
3-[3-(2-azidoethoxycarbonylsulfamoylamino)propanoyl-(2-carboxyethyl)amino]-3-tert-butyl-4,4-dimethylpentanoic acid (PubChem CID 175529906) has the molecular formula C20H36N6O9S and a molecular weight of 536.61 g/mol. Its IUPAC name is 3-[3-(2-azidoethoxycarbonylsulfamoylamino)propanoyl-(2-carboxyethyl)amino]-3-tert-butyl-4,4-dimethylpentanoic acid.
| Compound Name | 3-[3-(2-azidoethoxycarbonylsulfamoylamino)propanoyl-(2-carboxyethyl)amino]-3-tert-butyl-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 175529906 |
| Molecular Formula | C20H36N6O9S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 3-[3-(2-azidoethoxycarbonylsulfamoylamino)propanoyl-(2-carboxyethyl)amino]-3-tert-butyl-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)C(CC(=O)O)(N(CCC(=O)O)C(=O)CCNS(=O)(=O)NC(=O)OCCN=[N+]=[N-])C(C)(C)C |
| InChI | InChI=1S/C20H36N6O9S/c1-18(2,3)20(13-16(30)31,19(4,5)6)26(11-8-15(28)29)14(27)7-9-23-36(33,34)24-17(32)35-12-10-22-25-21/h23H,7-13H2,1-6H3,(H,24,32)(H,28,29)(H,30,31) |
| InChIKey | NJKJCOKKVSSHAF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 228.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|