C11H17F2N3O2 — CID 175530466
tert-butyl N-[1-[1-(difluoromethyl)pyrazol-3-yl]ethyl]carbamate (PubChem CID 175530466) has the molecular formula C11H17F2N3O2 and a molecular weight of 261.27 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(difluoromethyl)pyrazol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(difluoromethyl)pyrazol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 175530466 |
| Molecular Formula | C11H17F2N3O2 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | tert-butyl N-[1-[1-(difluoromethyl)pyrazol-3-yl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C11H17F2N3O2/c1-7(14-10(17)18-11(2,3)4)8-5-6-16(15-8)9(12)13/h5-7,9H,1-4H3,(H,14,17) |
| InChIKey | FDAVDYIOMOPMIR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |