About 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde
5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde (PubChem CID 175530808) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde |
| PubChem CID | 175530808 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde |
| SMILES | CNCc1ccc2c(c1)CN(C=O)C2 |
| InChI | InChI=1S/C11H14N2O/c1-12-5-9-2-3-10-6-13(8-14)7-11(10)4-9/h2-4,8,12H,5-7H2,1H3 |
| InChIKey | CPPDHBYQLHDKFK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde?
The IUPAC name of 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde (CID 175530808) is 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde.
What is the SMILES notation for 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde?
The canonical SMILES for 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde is CNCc1ccc2c(c1)CN(C=O)C2.
What is the InChIKey of 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde?
The InChIKey is CPPDHBYQLHDKFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-12-5-9-2-3-10-6-13(8-14)7-11(10)4-9/h2-4,8,12H,5-7H2,1H3.
What are the key properties of 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde?
5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde has a molecular weight of 190.25 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylaminomethyl)-1,3-dihydroisoindole-2-carbaldehyde is sourced from PubChem (CID 175530808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).