About N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide
N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide (PubChem CID 175530946) has the molecular formula C31H30I2N2O2
and a molecular weight of 716.40 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide.
Molecular Properties
| Compound Name | N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide |
| PubChem CID | 175530946 |
| Molecular Formula | C31H30I2N2O2 |
| Molecular Weight | 716.40 g/mol |
| Exact Mass | 716.04 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1ccccc1I.Cc1ccc(NC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C17H18INO.C14H12INO/c1-3-12-8-7-9-13(4-2)16(12)19-17(20)14-10-5-6-11-15(14)18;1-10-6-8-11(9-7-10)16-14(17)12-4-2-3-5-13(12)15/h5-11H,3-4H2,1-2H3,(H,19,20);2-9H,1H3,(H,16,17) |
| InChIKey | KAPCUHUKAFEQSH-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 716.40 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide?
The IUPAC name of N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide (CID 175530946) is N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide.
What is the SMILES notation for N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide?
The canonical SMILES for N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide is CCc1cccc(CC)c1NC(=O)c1ccccc1I.Cc1ccc(NC(=O)c2ccccc2I)cc1.
What is the InChIKey of N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide?
The InChIKey is KAPCUHUKAFEQSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18INO.C14H12INO/c1-3-12-8-7-9-13(4-2)16(12)19-17(20)14-10-5-6-11-15(14)18;1-10-6-8-11(9-7-10)16-14(17)12-4-2-3-5-13(12)15/h5-11H,3-4H2,1-2H3,(H,19,20);2-9H,1H3,(H,16,17).
What are the key properties of N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide?
N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide has a molecular weight of 716.40 g/mol, XLogP of 8.52, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-diethylphenyl)-2-iodobenzamide;2-iodo-N-(4-methylphenyl)benzamide is sourced from PubChem (CID 175530946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).