About methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide
methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide (PubChem CID 175531341) has the molecular formula C7H17BrN2O2
and a molecular weight of 241.13 g/mol. Its IUPAC name is methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide.
Molecular Properties
| Compound Name | methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide |
| PubChem CID | 175531341 |
| Molecular Formula | C7H17BrN2O2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide |
| SMILES | Br.COC(=O)CCN(C)N(C)C |
| InChI | InChI=1S/C7H16N2O2.BrH/c1-8(2)9(3)6-5-7(10)11-4;/h5-6H2,1-4H3;1H |
| InChIKey | MACSUPKONJTJMP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide?
The IUPAC name of methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide (CID 175531341) is methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide.
What is the SMILES notation for methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide?
The canonical SMILES for methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide is Br.COC(=O)CCN(C)N(C)C.
What is the InChIKey of methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide?
The InChIKey is MACSUPKONJTJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2.BrH/c1-8(2)9(3)6-5-7(10)11-4;/h5-6H2,1-4H3;1H.
What are the key properties of methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide?
methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide has a molecular weight of 241.13 g/mol, XLogP of 0.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[dimethylamino(methyl)amino]propanoate;hydrobromide is sourced from PubChem (CID 175531341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).