About 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane
4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane (PubChem CID 175531918) has the molecular formula C9H9BrFIO3
and a molecular weight of 390.97 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane.
Molecular Properties
| Compound Name | 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane |
| PubChem CID | 175531918 |
| Molecular Formula | C9H9BrFIO3 |
| Molecular Weight | 390.97 g/mol |
| Exact Mass | 389.88 |
| IUPAC Name | 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane |
| SMILES | CCI.O=C(O)c1cc(F)c(Br)cc1O |
| InChI | InChI=1S/C7H4BrFO3.C2H5I/c8-4-2-6(10)3(7(11)12)1-5(4)9;1-2-3/h1-2,10H,(H,11,12);2H2,1H3 |
| InChIKey | ADVPAVYTURCXCR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.97 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane?
The IUPAC name of 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane (CID 175531918) is 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane.
What is the SMILES notation for 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane?
The canonical SMILES for 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane is CCI.O=C(O)c1cc(F)c(Br)cc1O.
What is the InChIKey of 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane?
The InChIKey is ADVPAVYTURCXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrFO3.C2H5I/c8-4-2-6(10)3(7(11)12)1-5(4)9;1-2-3/h1-2,10H,(H,11,12);2H2,1H3.
What are the key properties of 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane?
4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane has a molecular weight of 390.97 g/mol, XLogP of 3.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-fluoro-2-hydroxybenzoic acid;iodoethane is sourced from PubChem (CID 175531918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).