About 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid
1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid (PubChem CID 175532273) has the molecular formula C20H17BrO4S2
and a molecular weight of 465.39 g/mol. Its IUPAC name is 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid.
Molecular Properties
| Compound Name | 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid |
| PubChem CID | 175532273 |
| Molecular Formula | C20H17BrO4S2 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid |
| SMILES | C=Cc1ccc(Br)cc1.O=S(=O)(O)O.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H8S.C8H7Br.H2O4S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-7-3-5-8(9)6-4-7;1-5(2,3)4/h1-8H;2-6H,1H2;(H2,1,2,3,4) |
| InChIKey | RLTGOFLJWXJACZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid?
The IUPAC name of 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid (CID 175532273) is 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid.
What is the SMILES notation for 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid?
The canonical SMILES for 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid is C=Cc1ccc(Br)cc1.O=S(=O)(O)O.c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid?
The InChIKey is RLTGOFLJWXJACZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S.C8H7Br.H2O4S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-7-3-5-8(9)6-4-7;1-5(2,3)4/h1-8H;2-6H,1H2;(H2,1,2,3,4).
What are the key properties of 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid?
1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid has a molecular weight of 465.39 g/mol, XLogP of 6.49, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-ethenylbenzene;dibenzothiophene;sulfuric acid is sourced from PubChem (CID 175532273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).