C15H26GeO2S — CID 175532591
[1-(benzenesulfonyl)-3,3-dimethylbutyl]-trimethylgermane (PubChem CID 175532591) has the molecular formula C15H26GeO2S and a molecular weight of 343.05 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-3,3-dimethylbutyl]-trimethylgermane.
| Compound Name | [1-(benzenesulfonyl)-3,3-dimethylbutyl]-trimethylgermane |
|---|---|
| PubChem CID | 175532591 |
| Molecular Formula | C15H26GeO2S |
| Molecular Weight | 343.05 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [1-(benzenesulfonyl)-3,3-dimethylbutyl]-trimethylgermane |
| SMILES | CC(C)(C)CC(S(=O)(=O)c1ccccc1)[Ge](C)(C)C |
| InChI | InChI=1S/C15H26GeO2S/c1-15(2,3)12-14(16(4,5)6)19(17,18)13-10-8-7-9-11-13/h7-11,14H,12H2,1-6H3 |
| InChIKey | DYAGDZHDKNMINV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |