C19H17ClF4N2O7 — CID 175532697
2-[2-chloro-5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-4-fluorobenzoyl]oxy-5-methoxy-2-methylpentanoic acid (PubChem CID 175532697) has the molecular formula C19H17ClF4N2O7 and a molecular weight of 496.80 g/mol. Its IUPAC name is 2-[2-chloro-5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-4-fluorobenzoyl]oxy-5-methoxy-2-methylpentanoic acid.
| Compound Name | 2-[2-chloro-5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-4-fluorobenzoyl]oxy-5-methoxy-2-methylpentanoic acid |
|---|---|
| PubChem CID | 175532697 |
| Molecular Formula | C19H17ClF4N2O7 |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 2-[2-chloro-5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-4-fluorobenzoyl]oxy-5-methoxy-2-methylpentanoic acid |
| SMILES | COCCCC(C)(OC(=O)c1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)c(F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C19H17ClF4N2O7/c1-18(16(29)30,4-3-5-32-2)33-15(28)9-6-12(11(21)7-10(9)20)26-14(27)8-13(19(22,23)24)25-17(26)31/h6-8H,3-5H2,1-2H3,(H,25,31)(H,29,30) |
| InChIKey | IRUJOZBTHFVKOG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|