C26H32N2O10 — CID 175532958
2,3-dihydroxybutanedioic acid;[naphthalen-1-yloxy(oct-2-enoyl)amino] N-prop-2-enylcarbamate (PubChem CID 175532958) has the molecular formula C26H32N2O10 and a molecular weight of 532.55 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;[naphthalen-1-yloxy(oct-2-enoyl)amino] N-prop-2-enylcarbamate.
| Compound Name | 2,3-dihydroxybutanedioic acid;[naphthalen-1-yloxy(oct-2-enoyl)amino] N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 175532958 |
| Molecular Formula | C26H32N2O10 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;[naphthalen-1-yloxy(oct-2-enoyl)amino] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)ON(Oc1cccc2ccccc12)C(=O)C=CCCCCC.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C22H26N2O4.C4H6O6/c1-3-5-6-7-8-16-21(25)24(28-22(26)23-17-4-2)27-20-15-11-13-18-12-9-10-14-19(18)20;5-1(3(7)8)2(6)4(9)10/h4,8-16H,2-3,5-7,17H2,1H3,(H,23,26);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | DYLCBGBBZIFKQX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 182.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|