C16H14F9NOS — CID 175534060
1-(3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylsulfanylhexyl)pyrrolidin-2-one (PubChem CID 175534060) has the molecular formula C16H14F9NOS and a molecular weight of 439.34 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylsulfanylhexyl)pyrrolidin-2-one.
| Compound Name | 1-(3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylsulfanylhexyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 175534060 |
| Molecular Formula | C16H14F9NOS |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylsulfanylhexyl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)Sc1ccccc1 |
| InChI | InChI=1S/C16H14F9NOS/c17-13(18,14(19,20)15(21,22)16(23,24)25)9-12(26-8-4-7-11(26)27)28-10-5-2-1-3-6-10/h1-3,5-6,12H,4,7-9H2 |
| InChIKey | YLCCPOYPIMVSAC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|