About 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol
3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol (PubChem CID 175534236) has the molecular formula C20H36O3S2
and a molecular weight of 388.64 g/mol. Its IUPAC name is 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol.
Molecular Properties
| Compound Name | 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol |
| PubChem CID | 175534236 |
| Molecular Formula | C20H36O3S2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol |
| SMILES | CC1=CCC(C(C)(C)S)CC1.CCCC(CCOC(C)=O)SC(C)=O |
| InChI | InChI=1S/C10H18O3S.C10H18S/c1-4-5-10(14-9(3)12)6-7-13-8(2)11;1-8-4-6-9(7-5-8)10(2,3)11/h10H,4-7H2,1-3H3;4,9,11H,5-7H2,1-3H3 |
| InChIKey | JFQSGLDITVFYAG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol?
The IUPAC name of 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol (CID 175534236) is 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol.
What is the SMILES notation for 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol?
The canonical SMILES for 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol is CC1=CCC(C(C)(C)S)CC1.CCCC(CCOC(C)=O)SC(C)=O.
What is the InChIKey of 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol?
The InChIKey is JFQSGLDITVFYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3S.C10H18S/c1-4-5-10(14-9(3)12)6-7-13-8(2)11;1-8-4-6-9(7-5-8)10(2,3)11/h10H,4-7H2,1-3H3;4,9,11H,5-7H2,1-3H3.
What are the key properties of 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol?
3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol has a molecular weight of 388.64 g/mol, XLogP of 5.83, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetylsulfanylhexyl acetate;2-(4-methylcyclohex-3-en-1-yl)propane-2-thiol is sourced from PubChem (CID 175534236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).