About 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol
2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol (PubChem CID 175534280) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 175534280 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol |
| SMILES | CC1(CO)C=C(C(C)(C)C)C(O)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H28O2/c1-14(2,3)11-8-16(7,10-17)9-12(13(11)18)15(4,5)6/h8,17-18H,9-10H2,1-7H3 |
| InChIKey | WGYNZQJTLLUKEC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol?
The IUPAC name of 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol (CID 175534280) is 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol is CC1(CO)C=C(C(C)(C)C)C(O)=C(C(C)(C)C)C1.
What is the InChIKey of 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol?
The InChIKey is WGYNZQJTLLUKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-14(2,3)11-8-16(7,10-17)9-12(13(11)18)15(4,5)6/h8,17-18H,9-10H2,1-7H3.
What are the key properties of 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol?
2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol has a molecular weight of 252.40 g/mol, XLogP of 4.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-(hydroxymethyl)-4-methylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 175534280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).