(2S)-2-formamido-4-methylsulfanylbutanoyl fluoride

C6H10FNO2S — CID 175534597

IUPAC(2S)-2-formamido-4-methylsulfanylbutanoyl fluoride
SMILESCSCC[C@H](NC=O)C(=O)F
InChIInChI=1S/C6H10FNO2S/c1-11-3-2-5(6(7)10)8-4-9/h4-5H,2-3H2,1H3,(H,8,9)/t5-/m0/s1
InChIKeyZDQODBHLVWLAPR-YFKPBYRVSA-N
MW179.22 g/mol
LogP0.35
Rot. Bonds6

About (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride

(2S)-2-formamido-4-methylsulfanylbutanoyl fluoride (PubChem CID 175534597) has the molecular formula C6H10FNO2S and a molecular weight of 179.22 g/mol. Its IUPAC name is (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride.

Molecular Properties

Compound Name(2S)-2-formamido-4-methylsulfanylbutanoyl fluoride
PubChem CID175534597
Molecular FormulaC6H10FNO2S
Molecular Weight179.22 g/mol
Exact Mass179.04
IUPAC Name(2S)-2-formamido-4-methylsulfanylbutanoyl fluoride
SMILESCSCC[C@H](NC=O)C(=O)F
InChIInChI=1S/C6H10FNO2S/c1-11-3-2-5(6(7)10)8-4-9/h4-5H,2-3H2,1H3,(H,8,9)/t5-/m0/s1
InChIKeyZDQODBHLVWLAPR-YFKPBYRVSA-N
XLogP0.35
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.22
LogP ≤ 50.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride?
The IUPAC name of (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride (CID 175534597) is (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride.
What is the SMILES notation for (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride?
The canonical SMILES for (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride is CSCC[C@H](NC=O)C(=O)F.
What is the InChIKey of (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride?
The InChIKey is ZDQODBHLVWLAPR-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10FNO2S/c1-11-3-2-5(6(7)10)8-4-9/h4-5H,2-3H2,1H3,(H,8,9)/t5-/m0/s1.
What are the key properties of (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride?
(2S)-2-formamido-4-methylsulfanylbutanoyl fluoride has a molecular weight of 179.22 g/mol, XLogP of 0.35, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-formamido-4-methylsulfanylbutanoyl fluoride is sourced from PubChem (CID 175534597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).